C32H44N4O4S — CID 158318277
2-amino-8-[3-[3-(hydroxymethyl)azetidin-1-yl]sulfonylphenyl]-6-pentyl-N,N-dipropyl-3H-1-benzazepine-4-carboxamide (PubChem CID 158318277) has the molecular formula C32H44N4O4S and a molecular weight of 580.80 g/mol. Its IUPAC name is 2-amino-8-[3-[3-(hydroxymethyl)azetidin-1-yl]sulfonylphenyl]-6-pentyl-N,N-dipropyl-3H-1-benzazepine-4-carboxamide.
| Compound Name | 2-amino-8-[3-[3-(hydroxymethyl)azetidin-1-yl]sulfonylphenyl]-6-pentyl-N,N-dipropyl-3H-1-benzazepine-4-carboxamide |
|---|---|
| PubChem CID | 158318277 |
| Molecular Formula | C32H44N4O4S |
| Molecular Weight | 580.80 g/mol |
| Exact Mass | 580.31 |
| IUPAC Name | 2-amino-8-[3-[3-(hydroxymethyl)azetidin-1-yl]sulfonylphenyl]-6-pentyl-N,N-dipropyl-3H-1-benzazepine-4-carboxamide |
| SMILES | CCCCCc1cc(-c2cccc(S(=O)(=O)N3CC(CO)C3)c2)cc2c1C=C(C(=O)N(CCC)CCC)CC(N)=N2 |
| InChI | InChI=1S/C32H44N4O4S/c1-4-7-8-10-25-15-26(24-11-9-12-28(16-24)41(39,40)36-20-23(21-36)22-37)18-30-29(25)17-27(19-31(33)34-30)32(38)35(13-5-2)14-6-3/h9,11-12,15-18,23,37H,4-8,10,13-14,19-22H2,1-3H3,(H2,33,34) |
| InChIKey | CNACYPRYNQZXKI-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 116.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.80 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|