C26H33N5O5S — CID 163403073
2-amino-8-[3-[3-(aminomethyl)azetidin-1-yl]sulfonylphenyl]-N-(2-hydroxyethoxy)-N-propyl-3H-1-benzazepine-4-carboxamide (PubChem CID 163403073) has the molecular formula C26H33N5O5S and a molecular weight of 527.65 g/mol. Its IUPAC name is 2-amino-8-[3-[3-(aminomethyl)azetidin-1-yl]sulfonylphenyl]-N-(2-hydroxyethoxy)-N-propyl-3H-1-benzazepine-4-carboxamide.
| Compound Name | 2-amino-8-[3-[3-(aminomethyl)azetidin-1-yl]sulfonylphenyl]-N-(2-hydroxyethoxy)-N-propyl-3H-1-benzazepine-4-carboxamide |
|---|---|
| PubChem CID | 163403073 |
| Molecular Formula | C26H33N5O5S |
| Molecular Weight | 527.65 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | 2-amino-8-[3-[3-(aminomethyl)azetidin-1-yl]sulfonylphenyl]-N-(2-hydroxyethoxy)-N-propyl-3H-1-benzazepine-4-carboxamide |
| SMILES | CCCN(OCCO)C(=O)C1=Cc2ccc(-c3cccc(S(=O)(=O)N4CC(CN)C4)c3)cc2N=C(N)C1 |
| InChI | InChI=1S/C26H33N5O5S/c1-2-8-31(36-10-9-32)26(33)22-11-21-7-6-20(13-24(21)29-25(28)14-22)19-4-3-5-23(12-19)37(34,35)30-16-18(15-27)17-30/h3-7,11-13,18,32H,2,8-10,14-17,27H2,1H3,(H2,28,29) |
| InChIKey | OMHWYOLMESGYQB-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 151.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.65 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|