About 1-iodo-3-methylsulfonylpropane;3-methylsulfanylpropan-1-ol;3-methylsulfonylpropan-1-ol
1-iodo-3-methylsulfonylpropane;3-methylsulfanylpropan-1-ol;3-methylsulfonylpropan-1-ol (PubChem CID 158320314) has the molecular formula C12H29IO6S3
and a molecular weight of 492.46 g/mol. Its IUPAC name is 1-iodo-3-methylsulfonylpropane;3-methylsulfanylpropan-1-ol;3-methylsulfonylpropan-1-ol.
Molecular Properties
| Compound Name | 1-iodo-3-methylsulfonylpropane;3-methylsulfanylpropan-1-ol;3-methylsulfonylpropan-1-ol |
| PubChem CID | 158320314 |
| Molecular Formula | C12H29IO6S3 |
| Molecular Weight | 492.46 g/mol |
| Exact Mass | 492.02 |
| IUPAC Name | 1-iodo-3-methylsulfonylpropane;3-methylsulfanylpropan-1-ol;3-methylsulfonylpropan-1-ol |
| SMILES | CS(=O)(=O)CCCI.CS(=O)(=O)CCCO.CSCCCO |
| InChI | InChI=1S/C4H9IO2S.C4H10O3S.C4H10OS/c2*1-8(6,7)4-2-3-5;1-6-4-2-3-5/h2-4H2,1H3;5H,2-4H2,1H3;5H,2-4H2,1H3 |
| InChIKey | GOTNFTYWBNKJLU-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 492.46 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-iodo-3-methylsulfonylpropane;3-methylsulfanylpropan-1-ol;3-methylsulfonylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodo-3-methylsulfonylpropane;3-methylsulfanylpropan-1-ol;3-methylsulfonylpropan-1-ol?
The IUPAC name of 1-iodo-3-methylsulfonylpropane;3-methylsulfanylpropan-1-ol;3-methylsulfonylpropan-1-ol (CID 158320314) is 1-iodo-3-methylsulfonylpropane;3-methylsulfanylpropan-1-ol;3-methylsulfonylpropan-1-ol.
What is the SMILES notation for 1-iodo-3-methylsulfonylpropane;3-methylsulfanylpropan-1-ol;3-methylsulfonylpropan-1-ol?
The canonical SMILES for 1-iodo-3-methylsulfonylpropane;3-methylsulfanylpropan-1-ol;3-methylsulfonylpropan-1-ol is CS(=O)(=O)CCCI.CS(=O)(=O)CCCO.CSCCCO.
What is the InChIKey of 1-iodo-3-methylsulfonylpropane;3-methylsulfanylpropan-1-ol;3-methylsulfonylpropan-1-ol?
The InChIKey is GOTNFTYWBNKJLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9IO2S.C4H10O3S.C4H10OS/c2*1-8(6,7)4-2-3-5;1-6-4-2-3-5/h2-4H2,1H3;5H,2-4H2,1H3;5H,2-4H2,1H3.
What are the key properties of 1-iodo-3-methylsulfonylpropane;3-methylsulfanylpropan-1-ol;3-methylsulfonylpropan-1-ol?
1-iodo-3-methylsulfonylpropane;3-methylsulfanylpropan-1-ol;3-methylsulfonylpropan-1-ol has a molecular weight of 492.46 g/mol, XLogP of 1.00, 9 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodo-3-methylsulfonylpropane;3-methylsulfanylpropan-1-ol;3-methylsulfonylpropan-1-ol is sourced from PubChem (CID 158320314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).