C15H18ClN3O4 — CID 158320699
[7-(2-chloro-4-nitrophenyl)-7-azaspiro[3.5]nonan-2-yl] carbamate (PubChem CID 158320699) has the molecular formula C15H18ClN3O4 and a molecular weight of 339.78 g/mol. Its IUPAC name is [7-(2-chloro-4-nitrophenyl)-7-azaspiro[3.5]nonan-2-yl] carbamate.
| Compound Name | [7-(2-chloro-4-nitrophenyl)-7-azaspiro[3.5]nonan-2-yl] carbamate |
|---|---|
| PubChem CID | 158320699 |
| Molecular Formula | C15H18ClN3O4 |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | [7-(2-chloro-4-nitrophenyl)-7-azaspiro[3.5]nonan-2-yl] carbamate |
| SMILES | NC(=O)OC1CC2(CCN(c3ccc([N+](=O)[O-])cc3Cl)CC2)C1 |
| InChI | InChI=1S/C15H18ClN3O4/c16-12-7-10(19(21)22)1-2-13(12)18-5-3-15(4-6-18)8-11(9-15)23-14(17)20/h1-2,7,11H,3-6,8-9H2,(H2,17,20) |
| InChIKey | GOUSCWUIMCENDC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|