C15H20N4O4 — CID 175174692
[7-(4-amino-2-nitrophenyl)-7-azaspiro[3.5]nonan-2-yl] carbamate (PubChem CID 175174692) has the molecular formula C15H20N4O4 and a molecular weight of 320.35 g/mol. Its IUPAC name is [7-(4-amino-2-nitrophenyl)-7-azaspiro[3.5]nonan-2-yl] carbamate.
| Compound Name | [7-(4-amino-2-nitrophenyl)-7-azaspiro[3.5]nonan-2-yl] carbamate |
|---|---|
| PubChem CID | 175174692 |
| Molecular Formula | C15H20N4O4 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | [7-(4-amino-2-nitrophenyl)-7-azaspiro[3.5]nonan-2-yl] carbamate |
| SMILES | NC(=O)OC1CC2(CCN(c3ccc(N)cc3[N+](=O)[O-])CC2)C1 |
| InChI | InChI=1S/C15H20N4O4/c16-10-1-2-12(13(7-10)19(21)22)18-5-3-15(4-6-18)8-11(9-15)23-14(17)20/h1-2,7,11H,3-6,8-9,16H2,(H2,17,20) |
| InChIKey | XBZTVGJHYXTQFQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 124.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|