C28H56 — CID 158321303
(Z)-5,7-dimethyloct-3-ene;(E)-5,7-dimethyloct-3-ene;3-ethyl-3-methylpent-1-ene (PubChem CID 158321303) has the molecular formula C28H56 and a molecular weight of 392.76 g/mol. Its IUPAC name is (Z)-5,7-dimethyloct-3-ene;(E)-5,7-dimethyloct-3-ene;3-ethyl-3-methylpent-1-ene.
| Compound Name | (Z)-5,7-dimethyloct-3-ene;(E)-5,7-dimethyloct-3-ene;3-ethyl-3-methylpent-1-ene |
|---|---|
| PubChem CID | 158321303 |
| Molecular Formula | C28H56 |
| Molecular Weight | 392.76 g/mol |
| Exact Mass | 392.44 |
| IUPAC Name | (Z)-5,7-dimethyloct-3-ene;(E)-5,7-dimethyloct-3-ene;3-ethyl-3-methylpent-1-ene |
| SMILES | C=CC(C)(CC)CC.CC/C=C/C(C)CC(C)C.CC/C=C\C(C)CC(C)C |
| InChI | InChI=1S/2C10H20.C8H16/c2*1-5-6-7-10(4)8-9(2)3;1-5-8(4,6-2)7-3/h2*6-7,9-10H,5,8H2,1-4H3;5H,1,6-7H2,2-4H3/b7-6+;7-6-; |
| InChIKey | GOWOXYJHACOYKD-RWANGNOISA-N |
| XLogP | 10.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.76 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|