C12H25NS — CID 123335153
3,5-dimethylnon-6-en-2-ylsulfanylmethanamine (PubChem CID 123335153) has the molecular formula C12H25NS and a molecular weight of 215.41 g/mol. Its IUPAC name is 3,5-dimethylnon-6-en-2-ylsulfanylmethanamine.
| Compound Name | 3,5-dimethylnon-6-en-2-ylsulfanylmethanamine |
|---|---|
| PubChem CID | 123335153 |
| Molecular Formula | C12H25NS |
| Molecular Weight | 215.41 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 3,5-dimethylnon-6-en-2-ylsulfanylmethanamine |
| SMILES | CCC=CC(C)CC(C)C(C)SCN |
| InChI | InChI=1S/C12H25NS/c1-5-6-7-10(2)8-11(3)12(4)14-9-13/h6-7,10-12H,5,8-9,13H2,1-4H3 |
| InChIKey | GUVVGTKGVDTICS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|