C39H29Br2N3O6 — CID 158322525
4-bromobenzaldehyde;4-(4-bromophenyl)-2,6-bis(4-nitrophenyl)pyridine;1-(4-methylphenyl)ethanone (PubChem CID 158322525) has the molecular formula C39H29Br2N3O6 and a molecular weight of 795.48 g/mol. Its IUPAC name is 4-bromobenzaldehyde;4-(4-bromophenyl)-2,6-bis(4-nitrophenyl)pyridine;1-(4-methylphenyl)ethanone.
| Compound Name | 4-bromobenzaldehyde;4-(4-bromophenyl)-2,6-bis(4-nitrophenyl)pyridine;1-(4-methylphenyl)ethanone |
|---|---|
| PubChem CID | 158322525 |
| Molecular Formula | C39H29Br2N3O6 |
| Molecular Weight | 795.48 g/mol |
| Exact Mass | 793.04 |
| IUPAC Name | 4-bromobenzaldehyde;4-(4-bromophenyl)-2,6-bis(4-nitrophenyl)pyridine;1-(4-methylphenyl)ethanone |
| SMILES | CC(=O)c1ccc(C)cc1.O=Cc1ccc(Br)cc1.O=[N+]([O-])c1ccc(-c2cc(-c3ccc(Br)cc3)cc(-c3ccc([N+](=O)[O-])cc3)n2)cc1 |
| InChI | InChI=1S/C23H14BrN3O4.C9H10O.C7H5BrO/c24-19-7-1-15(2-8-19)18-13-22(16-3-9-20(10-4-16)26(28)29)25-23(14-18)17-5-11-21(12-6-17)27(30)31;1-7-3-5-9(6-4-7)8(2)10;8-7-3-1-6(5-9)2-4-7/h1-14H;3-6H,1-2H3;1-5H |
| InChIKey | GPAFUBAIPIGEDK-UHFFFAOYSA-N |
| XLogP | 11.12 |
| TPSA | 133.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.48 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|