C50H36Br3NO2 — CID 161259091
2,6-bis(4-bromophenyl)-4-(4-phenylphenyl)pyridine;1-(4-bromophenyl)ethanone;4-phenylbenzaldehyde (PubChem CID 161259091) has the molecular formula C50H36Br3NO2 and a molecular weight of 922.56 g/mol. Its IUPAC name is 2,6-bis(4-bromophenyl)-4-(4-phenylphenyl)pyridine;1-(4-bromophenyl)ethanone;4-phenylbenzaldehyde.
| Compound Name | 2,6-bis(4-bromophenyl)-4-(4-phenylphenyl)pyridine;1-(4-bromophenyl)ethanone;4-phenylbenzaldehyde |
|---|---|
| PubChem CID | 161259091 |
| Molecular Formula | C50H36Br3NO2 |
| Molecular Weight | 922.56 g/mol |
| Exact Mass | 919.03 |
| IUPAC Name | 2,6-bis(4-bromophenyl)-4-(4-phenylphenyl)pyridine;1-(4-bromophenyl)ethanone;4-phenylbenzaldehyde |
| SMILES | Brc1ccc(-c2cc(-c3ccc(-c4ccccc4)cc3)cc(-c3ccc(Br)cc3)n2)cc1.CC(=O)c1ccc(Br)cc1.O=Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H19Br2N.C13H10O.C8H7BrO/c30-26-14-10-23(11-15-26)28-18-25(19-29(32-28)24-12-16-27(31)17-13-24)22-8-6-21(7-9-22)20-4-2-1-3-5-20;14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12;1-6(10)7-2-4-8(9)5-3-7/h1-19H;1-10H;2-5H,1H3 |
| InChIKey | VCHWNVZNFQMFLU-UHFFFAOYSA-N |
| XLogP | 15.09 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 922.56 |
| LogP ≤ 5 | 15.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|