C26H40N2O10P2+2 — CID 15832283
2-[2-[2-oxo-2-(4,4,8,8-tetramethyl-2-oxo-1,3,6,2-dioxazaphosphocan-2-ium-6-yl)ethoxy]phenoxy]-1-(4,4,8,8-tetramethyl-2-oxo-1,3,6,2-dioxazaphosphocan-2-ium-6-yl)ethanone (PubChem CID 15832283) has the molecular formula C26H40N2O10P2+2 and a molecular weight of 602.56 g/mol. Its IUPAC name is 2-[2-[2-oxo-2-(4,4,8,8-tetramethyl-2-oxo-1,3,6,2-dioxazaphosphocan-2-ium-6-yl)ethoxy]phenoxy]-1-(4,4,8,8-tetramethyl-2-oxo-1,3,6,2-dioxazaphosphocan-2-ium-6-yl)ethanone.
| Compound Name | 2-[2-[2-oxo-2-(4,4,8,8-tetramethyl-2-oxo-1,3,6,2-dioxazaphosphocan-2-ium-6-yl)ethoxy]phenoxy]-1-(4,4,8,8-tetramethyl-2-oxo-1,3,6,2-dioxazaphosphocan-2-ium-6-yl)ethanone |
|---|---|
| PubChem CID | 15832283 |
| Molecular Formula | C26H40N2O10P2+2 |
| Molecular Weight | 602.56 g/mol |
| Exact Mass | 602.21 |
| IUPAC Name | 2-[2-[2-oxo-2-(4,4,8,8-tetramethyl-2-oxo-1,3,6,2-dioxazaphosphocan-2-ium-6-yl)ethoxy]phenoxy]-1-(4,4,8,8-tetramethyl-2-oxo-1,3,6,2-dioxazaphosphocan-2-ium-6-yl)ethanone |
| SMILES | CC1(C)CN(C(=O)COc2ccccc2OCC(=O)N2CC(C)(C)O[P+](=O)OC(C)(C)C2)CC(C)(C)O[P+](=O)O1 |
| InChI | InChI=1S/C26H40N2O10P2/c1-23(2)15-27(16-24(3,4)36-39(31)35-23)21(29)13-33-19-11-9-10-12-20(19)34-14-22(30)28-17-25(5,6)37-40(32)38-26(7,8)18-28/h9-12H,13-18H2,1-8H3/q+2 |
| InChIKey | WLFJYKSTAYUQBE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 130.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.56 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|