C33H31N3O5 — CID 158323255
methyl 3-[4-[[2-[[4-(aminomethyl)benzoyl]amino]-3-(3-phenoxyphenyl)propanoyl]amino]phenyl]prop-2-enoate (PubChem CID 158323255) has the molecular formula C33H31N3O5 and a molecular weight of 549.63 g/mol. Its IUPAC name is methyl 3-[4-[[2-[[4-(aminomethyl)benzoyl]amino]-3-(3-phenoxyphenyl)propanoyl]amino]phenyl]prop-2-enoate.
| Compound Name | methyl 3-[4-[[2-[[4-(aminomethyl)benzoyl]amino]-3-(3-phenoxyphenyl)propanoyl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 158323255 |
| Molecular Formula | C33H31N3O5 |
| Molecular Weight | 549.63 g/mol |
| Exact Mass | 549.23 |
| IUPAC Name | methyl 3-[4-[[2-[[4-(aminomethyl)benzoyl]amino]-3-(3-phenoxyphenyl)propanoyl]amino]phenyl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1ccc(NC(=O)C(Cc2cccc(Oc3ccccc3)c2)NC(=O)c2ccc(CN)cc2)cc1 |
| InChI | InChI=1S/C33H31N3O5/c1-40-31(37)19-14-23-12-17-27(18-13-23)35-33(39)30(36-32(38)26-15-10-24(22-34)11-16-26)21-25-6-5-9-29(20-25)41-28-7-3-2-4-8-28/h2-20,30H,21-22,34H2,1H3,(H,35,39)(H,36,38) |
| InChIKey | GPCHYNKWMTUTKB-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.63 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|