C45H55BrN8O4 — CID 158323282
5-bromo-1-methyl-3-(2-methyl-4-pyridinyl)-6-nitroindazole;5-butyl-5-ethenylnonane;5-ethenyl-1-methyl-3-(2-methyl-4-pyridinyl)-6-nitroindazole (PubChem CID 158323282) has the molecular formula C45H55BrN8O4 and a molecular weight of 851.89 g/mol. Its IUPAC name is 5-bromo-1-methyl-3-(2-methyl-4-pyridinyl)-6-nitroindazole;5-butyl-5-ethenylnonane;5-ethenyl-1-methyl-3-(2-methyl-4-pyridinyl)-6-nitroindazole.
| Compound Name | 5-bromo-1-methyl-3-(2-methyl-4-pyridinyl)-6-nitroindazole;5-butyl-5-ethenylnonane;5-ethenyl-1-methyl-3-(2-methyl-4-pyridinyl)-6-nitroindazole |
|---|---|
| PubChem CID | 158323282 |
| Molecular Formula | C45H55BrN8O4 |
| Molecular Weight | 851.89 g/mol |
| Exact Mass | 850.35 |
| IUPAC Name | 5-bromo-1-methyl-3-(2-methyl-4-pyridinyl)-6-nitroindazole;5-butyl-5-ethenylnonane;5-ethenyl-1-methyl-3-(2-methyl-4-pyridinyl)-6-nitroindazole |
| SMILES | C=CC(CCCC)(CCCC)CCCC.C=Cc1cc2c(-c3ccnc(C)c3)nn(C)c2cc1[N+](=O)[O-].Cc1cc(-c2nn(C)c3cc([N+](=O)[O-])c(Br)cc23)ccn1 |
| InChI | InChI=1S/C16H14N4O2.C15H30.C14H11BrN4O2/c1-4-11-8-13-15(9-14(11)20(21)22)19(3)18-16(13)12-5-6-17-10(2)7-12;1-5-9-12-15(8-4,13-10-6-2)14-11-7-3;1-8-5-9(3-4-16-8)14-10-6-11(15)13(19(20)21)7-12(10)18(2)17-14/h4-9H,1H2,2-3H3;8H,4-7,9-14H2,1-3H3;3-7H,1-2H3 |
| InChIKey | GPCJWAKZFHNGCG-UHFFFAOYSA-N |
| XLogP | 12.84 |
| TPSA | 147.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.89 |
| LogP ≤ 5 | 12.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|