C21H21F2NO3S — CID 158323385
(5E)-10-fluoro-12-[(2-fluoro-4-methylphenyl)methyl]spiro[4,7-dihydro-1H-8,2λ6,1-benzoxathiazecine-3,1'-cyclopropane] 2,2-dioxide (PubChem CID 158323385) has the molecular formula C21H21F2NO3S and a molecular weight of 405.47 g/mol. Its IUPAC name is (5E)-10-fluoro-12-[(2-fluoro-4-methylphenyl)methyl]spiro[4,7-dihydro-1H-8,2λ6,1-benzoxathiazecine-3,1'-cyclopropane] 2,2-dioxide.
| Compound Name | (5E)-10-fluoro-12-[(2-fluoro-4-methylphenyl)methyl]spiro[4,7-dihydro-1H-8,2λ6,1-benzoxathiazecine-3,1'-cyclopropane] 2,2-dioxide |
|---|---|
| PubChem CID | 158323385 |
| Molecular Formula | C21H21F2NO3S |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | (5E)-10-fluoro-12-[(2-fluoro-4-methylphenyl)methyl]spiro[4,7-dihydro-1H-8,2λ6,1-benzoxathiazecine-3,1'-cyclopropane] 2,2-dioxide |
| SMILES | Cc1ccc(Cc2cc(F)cc3c2NS(=O)(=O)C2(C/C=C/CO3)CC2)c(F)c1 |
| InChI | InChI=1S/C21H21F2NO3S/c1-14-4-5-15(18(23)10-14)11-16-12-17(22)13-19-20(16)24-28(25,26)21(7-8-21)6-2-3-9-27-19/h2-5,10,12-13,24H,6-9,11H2,1H3/b3-2+ |
| InChIKey | ZYKCNGIGTFOCOJ-NSCUHMNNSA-N |
| XLogP | 4.48 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|