C20H21F3N2O3S — CID 123577354
10,11-difluoro-N-(2-fluoro-4-methylphenyl)-2,2-dioxospiro[4,5,6,7-tetrahydro-1H-8,2λ6,1-benzoxathiazecine-3,1'-cyclopropane]-12-amine (PubChem CID 123577354) has the molecular formula C20H21F3N2O3S and a molecular weight of 426.46 g/mol. Its IUPAC name is 10,11-difluoro-N-(2-fluoro-4-methylphenyl)-2,2-dioxospiro[4,5,6,7-tetrahydro-1H-8,2λ6,1-benzoxathiazecine-3,1'-cyclopropane]-12-amine.
| Compound Name | 10,11-difluoro-N-(2-fluoro-4-methylphenyl)-2,2-dioxospiro[4,5,6,7-tetrahydro-1H-8,2λ6,1-benzoxathiazecine-3,1'-cyclopropane]-12-amine |
|---|---|
| PubChem CID | 123577354 |
| Molecular Formula | C20H21F3N2O3S |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 10,11-difluoro-N-(2-fluoro-4-methylphenyl)-2,2-dioxospiro[4,5,6,7-tetrahydro-1H-8,2λ6,1-benzoxathiazecine-3,1'-cyclopropane]-12-amine |
| SMILES | Cc1ccc(Nc2c(F)c(F)cc3c2NS(=O)(=O)C2(CCCCO3)CC2)c(F)c1 |
| InChI | InChI=1S/C20H21F3N2O3S/c1-12-4-5-15(13(21)10-12)24-19-17(23)14(22)11-16-18(19)25-29(26,27)20(7-8-20)6-2-3-9-28-16/h4-5,10-11,24-25H,2-3,6-9H2,1H3 |
| InChIKey | IUACCUNREFZFEW-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |