C20H22F3N3 — CID 143879920
6-(2-cyclopenta-1,3-dien-1-ylhydrazinyl)-2,3-difluoro-N-(2-fluoro-4-methylphenyl)aniline;ethane (PubChem CID 143879920) has the molecular formula C20H22F3N3 and a molecular weight of 361.41 g/mol. Its IUPAC name is 6-(2-cyclopenta-1,3-dien-1-ylhydrazinyl)-2,3-difluoro-N-(2-fluoro-4-methylphenyl)aniline;ethane.
| Compound Name | 6-(2-cyclopenta-1,3-dien-1-ylhydrazinyl)-2,3-difluoro-N-(2-fluoro-4-methylphenyl)aniline;ethane |
|---|---|
| PubChem CID | 143879920 |
| Molecular Formula | C20H22F3N3 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 6-(2-cyclopenta-1,3-dien-1-ylhydrazinyl)-2,3-difluoro-N-(2-fluoro-4-methylphenyl)aniline;ethane |
| SMILES | CC.Cc1ccc(Nc2c(NNC3=CC=CC3)ccc(F)c2F)c(F)c1 |
| InChI | InChI=1S/C18H16F3N3.C2H6/c1-11-6-8-15(14(20)10-11)22-18-16(9-7-13(19)17(18)21)24-23-12-4-2-3-5-12;1-2/h2-4,6-10,22-24H,5H2,1H3;1-2H3 |
| InChIKey | HMSJYBNWPVCUMV-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|