C47H86O8 — CID 158324036
4-[2,6-dimethyl-2-(3-methylbutyl)heptanoyl]oxybutyl 2,10-dimethyl-2-(3-methylbutyl)undecanoate;4-prop-2-enoyloxybutyl 2-methylprop-2-enoate (PubChem CID 158324036) has the molecular formula C47H86O8 and a molecular weight of 779.20 g/mol. Its IUPAC name is 4-[2,6-dimethyl-2-(3-methylbutyl)heptanoyl]oxybutyl 2,10-dimethyl-2-(3-methylbutyl)undecanoate;4-prop-2-enoyloxybutyl 2-methylprop-2-enoate.
| Compound Name | 4-[2,6-dimethyl-2-(3-methylbutyl)heptanoyl]oxybutyl 2,10-dimethyl-2-(3-methylbutyl)undecanoate;4-prop-2-enoyloxybutyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 158324036 |
| Molecular Formula | C47H86O8 |
| Molecular Weight | 779.20 g/mol |
| Exact Mass | 778.63 |
| IUPAC Name | 4-[2,6-dimethyl-2-(3-methylbutyl)heptanoyl]oxybutyl 2,10-dimethyl-2-(3-methylbutyl)undecanoate;4-prop-2-enoyloxybutyl 2-methylprop-2-enoate |
| SMILES | C=CC(=O)OCCCCOC(=O)C(=C)C.CC(C)CCCCCCCC(C)(CCC(C)C)C(=O)OCCCCOC(=O)C(C)(CCCC(C)C)CCC(C)C |
| InChI | InChI=1S/C36H70O4.C11H16O4/c1-29(2)19-14-12-11-13-15-23-35(9,25-21-31(5)6)33(37)39-27-16-17-28-40-34(38)36(10,26-22-32(7)8)24-18-20-30(3)4;1-4-10(12)14-7-5-6-8-15-11(13)9(2)3/h29-32H,11-28H2,1-10H3;4H,1-2,5-8H2,3H3 |
| InChIKey | GPEPIBCLCWNULB-UHFFFAOYSA-N |
| XLogP | 12.57 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.20 |
| LogP ≤ 5 | 12.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|