C12H11NO2S — CID 15832490
methyl 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate (PubChem CID 15832490) has the molecular formula C12H11NO2S and a molecular weight of 233.29 g/mol. Its IUPAC name is methyl 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 15832490 |
| Molecular Formula | C12H11NO2S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | methyl 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(-c2ccccc2)nc1C |
| InChI | InChI=1S/C12H11NO2S/c1-8-10(12(14)15-2)16-11(13-8)9-6-4-3-5-7-9/h3-7H,1-2H3 |
| InChIKey | VHJZCEJBOOOTIS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |