C7H4BrN2W3- — CID 158327317
3-bromo-6-tritio-1,4-dihydropyrrolo[2,3-b]pyridin-4-ide;tungsten (PubChem CID 158327317) has the molecular formula C7H4BrN2W3- and a molecular weight of 749.56 g/mol. Its IUPAC name is 3-bromo-6-tritio-1,4-dihydropyrrolo[2,3-b]pyridin-4-ide;tungsten.
| Compound Name | 3-bromo-6-tritio-1,4-dihydropyrrolo[2,3-b]pyridin-4-ide;tungsten |
|---|---|
| PubChem CID | 158327317 |
| Molecular Formula | C7H4BrN2W3- |
| Molecular Weight | 749.56 g/mol |
| Exact Mass | 748.82 |
| IUPAC Name | 3-bromo-6-tritio-1,4-dihydropyrrolo[2,3-b]pyridin-4-ide;tungsten |
| SMILES | [3H]c1c[c-]c2c(Br)c[nH]c2n1.[W].[W].[W] |
| InChI | InChI=1S/C7H4BrN2.3W/c8-6-4-10-7-5(6)2-1-3-9-7;;;/h1,3-4H,(H,9,10);;;/q-1;;;/i3T;;; |
| InChIKey | MLPGODWPHWGZIQ-NDEWRLJRSA-N |
| XLogP | 2.12 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.56 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|