C19H40N2O4S — CID 158328738
cyclopentylmethanol;cyclopentylmethylhydrazine;cyclopentylmethyl methanesulfonate (PubChem CID 158328738) has the molecular formula C19H40N2O4S and a molecular weight of 392.61 g/mol. Its IUPAC name is cyclopentylmethanol;cyclopentylmethylhydrazine;cyclopentylmethyl methanesulfonate.
| Compound Name | cyclopentylmethanol;cyclopentylmethylhydrazine;cyclopentylmethyl methanesulfonate |
|---|---|
| PubChem CID | 158328738 |
| Molecular Formula | C19H40N2O4S |
| Molecular Weight | 392.61 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | cyclopentylmethanol;cyclopentylmethylhydrazine;cyclopentylmethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCC1CCCC1.NNCC1CCCC1.OCC1CCCC1 |
| InChI | InChI=1S/C7H14O3S.C6H14N2.C6H12O/c1-11(8,9)10-6-7-4-2-3-5-7;7-8-5-6-3-1-2-4-6;7-5-6-3-1-2-4-6/h7H,2-6H2,1H3;6,8H,1-5,7H2;6-7H,1-5H2 |
| InChIKey | GPSWGARAGNFSSB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.61 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|