About dibenzofuran-4-ylboronic acid;methyl 2-dibenzofuran-4-ylbenzoate;methyl 2-iodobenzoate
dibenzofuran-4-ylboronic acid;methyl 2-dibenzofuran-4-ylbenzoate;methyl 2-iodobenzoate (PubChem CID 158331377) has the molecular formula C40H30BIO8
and a molecular weight of 776.39 g/mol. Its IUPAC name is dibenzofuran-4-ylboronic acid;methyl 2-dibenzofuran-4-ylbenzoate;methyl 2-iodobenzoate.
Molecular Properties
| Compound Name | dibenzofuran-4-ylboronic acid;methyl 2-dibenzofuran-4-ylbenzoate;methyl 2-iodobenzoate |
| PubChem CID | 158331377 |
| Molecular Formula | C40H30BIO8 |
| Molecular Weight | 776.39 g/mol |
| Exact Mass | 776.11 |
| IUPAC Name | dibenzofuran-4-ylboronic acid;methyl 2-dibenzofuran-4-ylbenzoate;methyl 2-iodobenzoate |
| SMILES | COC(=O)c1ccccc1-c1cccc2c1oc1ccccc12.COC(=O)c1ccccc1I.OB(O)c1cccc2c1oc1ccccc12 |
| InChI | InChI=1S/C20H14O3.C12H9BO3.C8H7IO2/c1-22-20(21)17-9-3-2-7-13(17)15-10-6-11-16-14-8-4-5-12-18(14)23-19(15)16;14-13(15)10-6-3-5-9-8-4-1-2-7-11(8)16-12(9)10;1-11-8(10)6-4-2-3-5-7(6)9/h2-12H,1H3;1-7,14-15H;2-5H,1H3 |
| InChIKey | GQAZABUXYMOWLK-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 119.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 776.39 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze dibenzofuran-4-ylboronic acid;methyl 2-dibenzofuran-4-ylbenzoate;methyl 2-iodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzofuran-4-ylboronic acid;methyl 2-dibenzofuran-4-ylbenzoate;methyl 2-iodobenzoate?
The IUPAC name of dibenzofuran-4-ylboronic acid;methyl 2-dibenzofuran-4-ylbenzoate;methyl 2-iodobenzoate (CID 158331377) is dibenzofuran-4-ylboronic acid;methyl 2-dibenzofuran-4-ylbenzoate;methyl 2-iodobenzoate.
What is the SMILES notation for dibenzofuran-4-ylboronic acid;methyl 2-dibenzofuran-4-ylbenzoate;methyl 2-iodobenzoate?
The canonical SMILES for dibenzofuran-4-ylboronic acid;methyl 2-dibenzofuran-4-ylbenzoate;methyl 2-iodobenzoate is COC(=O)c1ccccc1-c1cccc2c1oc1ccccc12.COC(=O)c1ccccc1I.OB(O)c1cccc2c1oc1ccccc12.
What is the InChIKey of dibenzofuran-4-ylboronic acid;methyl 2-dibenzofuran-4-ylbenzoate;methyl 2-iodobenzoate?
The InChIKey is GQAZABUXYMOWLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14O3.C12H9BO3.C8H7IO2/c1-22-20(21)17-9-3-2-7-13(17)15-10-6-11-16-14-8-4-5-12-18(14)23-19(15)16;14-13(15)10-6-3-5-9-8-4-1-2-7-11(8)16-12(9)10;1-11-8(10)6-4-2-3-5-7(6)9/h2-12H,1H3;1-7,14-15H;2-5H,1H3.
What are the key properties of dibenzofuran-4-ylboronic acid;methyl 2-dibenzofuran-4-ylbenzoate;methyl 2-iodobenzoate?
dibenzofuran-4-ylboronic acid;methyl 2-dibenzofuran-4-ylbenzoate;methyl 2-iodobenzoate has a molecular weight of 776.39 g/mol, XLogP of 8.38, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzofuran-4-ylboronic acid;methyl 2-dibenzofuran-4-ylbenzoate;methyl 2-iodobenzoate is sourced from PubChem (CID 158331377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).