C25H18N2O5 — CID 169387636
dimethyl 3-dibenzofuran-4-yl-1-phenylpyrazole-4,5-dicarboxylate (PubChem CID 169387636) has the molecular formula C25H18N2O5 and a molecular weight of 426.43 g/mol. Its IUPAC name is dimethyl 3-dibenzofuran-4-yl-1-phenylpyrazole-4,5-dicarboxylate.
| Compound Name | dimethyl 3-dibenzofuran-4-yl-1-phenylpyrazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 169387636 |
| Molecular Formula | C25H18N2O5 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | dimethyl 3-dibenzofuran-4-yl-1-phenylpyrazole-4,5-dicarboxylate |
| SMILES | COC(=O)c1c(-c2cccc3c2oc2ccccc23)nn(-c2ccccc2)c1C(=O)OC |
| InChI | InChI=1S/C25H18N2O5/c1-30-24(28)20-21(26-27(22(20)25(29)31-2)15-9-4-3-5-10-15)18-13-8-12-17-16-11-6-7-14-19(16)32-23(17)18/h3-14H,1-2H3 |
| InChIKey | FHECFVGOKDULGQ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 83.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |