About azanium;copper(1+);oxido-(oxido(dioxo)chromio)oxy-dioxochromium
azanium;copper(1+);oxido-(oxido(dioxo)chromio)oxy-dioxochromium (PubChem CID 158332463) has the molecular formula H4Cr2CuNO7
and a molecular weight of 297.57 g/mol. Its IUPAC name is azanium;copper(1+);oxido-(oxido(dioxo)chromio)oxy-dioxochromium.
Molecular Properties
| Compound Name | azanium;copper(1+);oxido-(oxido(dioxo)chromio)oxy-dioxochromium |
| PubChem CID | 158332463 |
| Molecular Formula | H4Cr2CuNO7 |
| Molecular Weight | 297.57 g/mol |
| Exact Mass | 296.81 |
| IUPAC Name | azanium;copper(1+);oxido-(oxido(dioxo)chromio)oxy-dioxochromium |
| SMILES | O=[Cr](=O)([O-])O[Cr](=O)(=O)[O-].[Cu+].[NH4+] |
| InChI | InChI=1S/2Cr.Cu.H3N.7O/h;;;1H3;;;;;;;/q;;+1;;;;;;;2*-1/p+1 |
| InChIKey | GQEGAUCUOQDZLY-UHFFFAOYSA-O |
| XLogP | -2.55 |
| TPSA | 160.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.57 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze azanium;copper(1+);oxido-(oxido(dioxo)chromio)oxy-dioxochromium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;copper(1+);oxido-(oxido(dioxo)chromio)oxy-dioxochromium?
The IUPAC name of azanium;copper(1+);oxido-(oxido(dioxo)chromio)oxy-dioxochromium (CID 158332463) is azanium;copper(1+);oxido-(oxido(dioxo)chromio)oxy-dioxochromium.
What is the SMILES notation for azanium;copper(1+);oxido-(oxido(dioxo)chromio)oxy-dioxochromium?
The canonical SMILES for azanium;copper(1+);oxido-(oxido(dioxo)chromio)oxy-dioxochromium is O=[Cr](=O)([O-])O[Cr](=O)(=O)[O-].[Cu+].[NH4+].
What is the InChIKey of azanium;copper(1+);oxido-(oxido(dioxo)chromio)oxy-dioxochromium?
The InChIKey is GQEGAUCUOQDZLY-UHFFFAOYSA-O. The full InChI is InChI=1S/2Cr.Cu.H3N.7O/h;;;1H3;;;;;;;/q;;+1;;;;;;;2*-1/p+1.
What are the key properties of azanium;copper(1+);oxido-(oxido(dioxo)chromio)oxy-dioxochromium?
azanium;copper(1+);oxido-(oxido(dioxo)chromio)oxy-dioxochromium has a molecular weight of 297.57 g/mol, XLogP of -2.55, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;copper(1+);oxido-(oxido(dioxo)chromio)oxy-dioxochromium is sourced from PubChem (CID 158332463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).