About benzene;oxido-(oxido(dioxo)chromio)oxy-dioxochromium
benzene;oxido-(oxido(dioxo)chromio)oxy-dioxochromium (PubChem CID 163199057) has the molecular formula C12H12Cr2O7-2
and a molecular weight of 372.21 g/mol. Its IUPAC name is benzene;oxido-(oxido(dioxo)chromio)oxy-dioxochromium.
Molecular Properties
| Compound Name | benzene;oxido-(oxido(dioxo)chromio)oxy-dioxochromium |
| PubChem CID | 163199057 |
| Molecular Formula | C12H12Cr2O7-2 |
| Molecular Weight | 372.21 g/mol |
| Exact Mass | 371.94 |
| IUPAC Name | benzene;oxido-(oxido(dioxo)chromio)oxy-dioxochromium |
| SMILES | O=[Cr](=O)([O-])O[Cr](=O)(=O)[O-].c1ccccc1.c1ccccc1 |
| InChI | InChI=1S/2C6H6.2Cr.7O/c2*1-2-4-6-5-3-1;;;;;;;;;/h2*1-6H;;;;;;;;;/q;;;;;;;;;2*-1 |
| InChIKey | JYXUISWPOGYLOC-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 123.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.21 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze benzene;oxido-(oxido(dioxo)chromio)oxy-dioxochromium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;oxido-(oxido(dioxo)chromio)oxy-dioxochromium?
The IUPAC name of benzene;oxido-(oxido(dioxo)chromio)oxy-dioxochromium (CID 163199057) is benzene;oxido-(oxido(dioxo)chromio)oxy-dioxochromium.
What is the SMILES notation for benzene;oxido-(oxido(dioxo)chromio)oxy-dioxochromium?
The canonical SMILES for benzene;oxido-(oxido(dioxo)chromio)oxy-dioxochromium is O=[Cr](=O)([O-])O[Cr](=O)(=O)[O-].c1ccccc1.c1ccccc1.
What is the InChIKey of benzene;oxido-(oxido(dioxo)chromio)oxy-dioxochromium?
The InChIKey is JYXUISWPOGYLOC-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H6.2Cr.7O/c2*1-2-4-6-5-3-1;;;;;;;;;/h2*1-6H;;;;;;;;;/q;;;;;;;;;2*-1.
What are the key properties of benzene;oxido-(oxido(dioxo)chromio)oxy-dioxochromium?
benzene;oxido-(oxido(dioxo)chromio)oxy-dioxochromium has a molecular weight of 372.21 g/mol, XLogP of 0.45, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;oxido-(oxido(dioxo)chromio)oxy-dioxochromium is sourced from PubChem (CID 163199057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).