C11H11NO3 — CID 158338689
7-methoxy-6-methyl-1,4-dihydroquinoline-2,3-dione (PubChem CID 158338689) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is 7-methoxy-6-methyl-1,4-dihydroquinoline-2,3-dione.
| Compound Name | 7-methoxy-6-methyl-1,4-dihydroquinoline-2,3-dione |
|---|---|
| PubChem CID | 158338689 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 7-methoxy-6-methyl-1,4-dihydroquinoline-2,3-dione |
| SMILES | COc1cc2c(cc1C)CC(=O)C(=O)N2 |
| InChI | InChI=1S/C11H11NO3/c1-6-3-7-4-9(13)11(14)12-8(7)5-10(6)15-2/h3,5H,4H2,1-2H3,(H,12,14) |
| InChIKey | VDJUQXALRAEXSJ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|