C21H30F2N5O6PS — CID 158339005
S-[2-[[(4aS,6R,7R,7aS)-6-[6-(dimethylamino)-2-methylpurin-9-yl]-4a,7-difluoro-7-methyl-2-oxo-6,7a-dihydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]ethyl] 2,2-dimethylpropanethioate (PubChem CID 158339005) has the molecular formula C21H30F2N5O6PS and a molecular weight of 549.54 g/mol. Its IUPAC name is S-[2-[[(4aS,6R,7R,7aS)-6-[6-(dimethylamino)-2-methylpurin-9-yl]-4a,7-difluoro-7-methyl-2-oxo-6,7a-dihydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]ethyl] 2,2-dimethylpropanethioate.
| Compound Name | S-[2-[[(4aS,6R,7R,7aS)-6-[6-(dimethylamino)-2-methylpurin-9-yl]-4a,7-difluoro-7-methyl-2-oxo-6,7a-dihydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]ethyl] 2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 158339005 |
| Molecular Formula | C21H30F2N5O6PS |
| Molecular Weight | 549.54 g/mol |
| Exact Mass | 549.16 |
| IUPAC Name | S-[2-[[(4aS,6R,7R,7aS)-6-[6-(dimethylamino)-2-methylpurin-9-yl]-4a,7-difluoro-7-methyl-2-oxo-6,7a-dihydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]ethyl] 2,2-dimethylpropanethioate |
| SMILES | Cc1nc(N(C)C)c2ncn([C@@H]3O[C@]4(F)COP(=O)(OCCSC(=O)C(C)(C)C)O[C@H]4[C@@]3(C)F)c2n1 |
| InChI | InChI=1S/C21H30F2N5O6PS/c1-12-25-14(27(6)7)13-15(26-12)28(11-24-13)17-20(5,22)16-21(23,33-17)10-32-35(30,34-16)31-8-9-36-18(29)19(2,3)4/h11,16-17H,8-10H2,1-7H3/t16-,17+,20+,21+,35?/m0/s1 |
| InChIKey | ZRMPJVHPHBXXRR-QETPZQPCSA-N |
| XLogP | 3.97 |
| TPSA | 117.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.54 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|