C16H32O10P2 — CID 158344892
1-(2-butyl-4-methylphenyl)-2,2-bis(hydroxymethyl)propane-1,3-diol;phosphorous acid (PubChem CID 158344892) has the molecular formula C16H32O10P2 and a molecular weight of 446.37 g/mol. Its IUPAC name is 1-(2-butyl-4-methylphenyl)-2,2-bis(hydroxymethyl)propane-1,3-diol;phosphorous acid.
| Compound Name | 1-(2-butyl-4-methylphenyl)-2,2-bis(hydroxymethyl)propane-1,3-diol;phosphorous acid |
|---|---|
| PubChem CID | 158344892 |
| Molecular Formula | C16H32O10P2 |
| Molecular Weight | 446.37 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 1-(2-butyl-4-methylphenyl)-2,2-bis(hydroxymethyl)propane-1,3-diol;phosphorous acid |
| SMILES | CCCCc1cc(C)ccc1C(O)C(CO)(CO)CO.OP(O)O.OP(O)O |
| InChI | InChI=1S/C16H26O4.2H3O3P/c1-3-4-5-13-8-12(2)6-7-14(13)15(20)16(9-17,10-18)11-19;2*1-4(2)3/h6-8,15,17-20H,3-5,9-11H2,1-2H3;2*1-3H |
| InChIKey | GRPLVFKZMKMBEX-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 202.30 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.37 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|