C22H42O3Si2 — CID 15834601
2-trimethylsilylethyl (E,4S,5R)-4-methyl-5-tri(propan-2-yl)silyloxyhept-2-en-6-ynoate (PubChem CID 15834601) has the molecular formula C22H42O3Si2 and a molecular weight of 410.75 g/mol. Its IUPAC name is 2-trimethylsilylethyl (E,4S,5R)-4-methyl-5-tri(propan-2-yl)silyloxyhept-2-en-6-ynoate.
| Compound Name | 2-trimethylsilylethyl (E,4S,5R)-4-methyl-5-tri(propan-2-yl)silyloxyhept-2-en-6-ynoate |
|---|---|
| PubChem CID | 15834601 |
| Molecular Formula | C22H42O3Si2 |
| Molecular Weight | 410.75 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | 2-trimethylsilylethyl (E,4S,5R)-4-methyl-5-tri(propan-2-yl)silyloxyhept-2-en-6-ynoate |
| SMILES | C#C[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C)/C=C/C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C22H42O3Si2/c1-12-21(25-27(17(2)3,18(4)5)19(6)7)20(8)13-14-22(23)24-15-16-26(9,10)11/h1,13-14,17-21H,15-16H2,2-11H3/b14-13+/t20-,21-/m0/s1 |
| InChIKey | XKWLJUJWZZHIMA-UQFLNUTESA-N |
| XLogP | 6.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.75 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|