C15H26O3 — CID 158357918
(1S,3S,4R,5S)-3-methoxy-4,8-dimethyl-2,13-dioxatricyclo[7.4.1.05,14]tetradecane (PubChem CID 158357918) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (1S,3S,4R,5S)-3-methoxy-4,8-dimethyl-2,13-dioxatricyclo[7.4.1.05,14]tetradecane.
| Compound Name | (1S,3S,4R,5S)-3-methoxy-4,8-dimethyl-2,13-dioxatricyclo[7.4.1.05,14]tetradecane |
|---|---|
| PubChem CID | 158357918 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (1S,3S,4R,5S)-3-methoxy-4,8-dimethyl-2,13-dioxatricyclo[7.4.1.05,14]tetradecane |
| SMILES | CO[C@H]1O[C@@H]2OCCCC3C(C)CC[C@H](C32)[C@H]1C |
| InChI | InChI=1S/C15H26O3/c1-9-6-7-12-10(2)14(16-3)18-15-13(12)11(9)5-4-8-17-15/h9-15H,4-8H2,1-3H3/t9?,10-,11?,12+,13?,14+,15+/m1/s1 |
| InChIKey | MMXMDHUCRDSKDU-VIRCCYPESA-N |
| XLogP | 3.04 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |