C40H40NiP4 — CID 15836530
2-(4,5-dimethylphosphinin-2-yl)-4,5-dimethylphosphinine;2-diphenylphosphanylethyl(diphenyl)phosphane;nickel (PubChem CID 15836530) has the molecular formula C40H40NiP4 and a molecular weight of 703.35 g/mol. Its IUPAC name is 2-(4,5-dimethylphosphinin-2-yl)-4,5-dimethylphosphinine;2-diphenylphosphanylethyl(diphenyl)phosphane;nickel.
| Compound Name | 2-(4,5-dimethylphosphinin-2-yl)-4,5-dimethylphosphinine;2-diphenylphosphanylethyl(diphenyl)phosphane;nickel |
|---|---|
| PubChem CID | 15836530 |
| Molecular Formula | C40H40NiP4 |
| Molecular Weight | 703.35 g/mol |
| Exact Mass | 702.14 |
| IUPAC Name | 2-(4,5-dimethylphosphinin-2-yl)-4,5-dimethylphosphinine;2-diphenylphosphanylethyl(diphenyl)phosphane;nickel |
| SMILES | Cc1cpc(-c2cc(C)c(C)cp2)cc1C.[Ni].c1ccc(P(CCP(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H24P2.C14H16P2.Ni/c1-5-13-23(14-6-1)27(24-15-7-2-8-16-24)21-22-28(25-17-9-3-10-18-25)26-19-11-4-12-20-26;1-9-5-13(15-7-11(9)3)14-6-10(2)12(4)8-16-14;/h1-20H,21-22H2;5-8H,1-4H3; |
| InChIKey | ADLDKKBBYHGWNM-UHFFFAOYSA-N |
| XLogP | 11.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.35 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|