C10H17FO7 — CID 158376157
(2S,4R,5R)-6-[(1R,2R)-1-fluoro-2,3-dihydroxypropyl]-2,4-dihydroxy-5-methyloxane-2-carboxylic acid (PubChem CID 158376157) has the molecular formula C10H17FO7 and a molecular weight of 268.24 g/mol. Its IUPAC name is (2S,4R,5R)-6-[(1R,2R)-1-fluoro-2,3-dihydroxypropyl]-2,4-dihydroxy-5-methyloxane-2-carboxylic acid.
| Compound Name | (2S,4R,5R)-6-[(1R,2R)-1-fluoro-2,3-dihydroxypropyl]-2,4-dihydroxy-5-methyloxane-2-carboxylic acid |
|---|---|
| PubChem CID | 158376157 |
| Molecular Formula | C10H17FO7 |
| Molecular Weight | 268.24 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | (2S,4R,5R)-6-[(1R,2R)-1-fluoro-2,3-dihydroxypropyl]-2,4-dihydroxy-5-methyloxane-2-carboxylic acid |
| SMILES | C[C@H]1C([C@H](F)[C@H](O)CO)O[C@](O)(C(=O)O)C[C@H]1O |
| InChI | InChI=1S/C10H17FO7/c1-4-5(13)2-10(17,9(15)16)18-8(4)7(11)6(14)3-12/h4-8,12-14,17H,2-3H2,1H3,(H,15,16)/t4-,5-,6-,7-,8?,10+/m1/s1 |
| InChIKey | GVFLCWSRYLCNNF-RQHIPLNYSA-N |
| XLogP | -1.76 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.24 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |