C11H15N — CID 158376445
(1R)-1-propan-2-yl-2,3-dihydro-1H-isoindole (PubChem CID 158376445) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is (1R)-1-propan-2-yl-2,3-dihydro-1H-isoindole.
| Compound Name | (1R)-1-propan-2-yl-2,3-dihydro-1H-isoindole |
|---|---|
| PubChem CID | 158376445 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | (1R)-1-propan-2-yl-2,3-dihydro-1H-isoindole |
| SMILES | CC(C)[C@H]1NCc2ccccc21 |
| InChI | InChI=1S/C11H15N/c1-8(2)11-10-6-4-3-5-9(10)7-12-11/h3-6,8,11-12H,7H2,1-2H3/t11-/m1/s1 |
| InChIKey | KBOBAQOAQXTNCU-LLVKDONJSA-N |
| XLogP | 2.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |