About (1R)-1-propan-2-yl-2,3-dihydro-1H-isoindole
(1R)-1-propan-2-yl-2,3-dihydro-1H-isoindole (PubChem CID 158376445) has the molecular formula C11H15N
and a molecular weight of 161.25 g/mol. Its IUPAC name is (1R)-1-propan-2-yl-2,3-dihydro-1H-isoindole.
Molecular Properties
| Compound Name | (1R)-1-propan-2-yl-2,3-dihydro-1H-isoindole |
| PubChem CID | 158376445 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | (1R)-1-propan-2-yl-2,3-dihydro-1H-isoindole |
| SMILES | CC(C)[C@H]1NCc2ccccc21 |
| InChI | InChI=1S/C11H15N/c1-8(2)11-10-6-4-3-5-9(10)7-12-11/h3-6,8,11-12H,7H2,1-2H3/t11-/m1/s1 |
| InChIKey | KBOBAQOAQXTNCU-LLVKDONJSA-N |
| XLogP | 2.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1R)-1-propan-2-yl-2,3-dihydro-1H-isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-propan-2-yl-2,3-dihydro-1H-isoindole?
The IUPAC name of (1R)-1-propan-2-yl-2,3-dihydro-1H-isoindole (CID 158376445) is (1R)-1-propan-2-yl-2,3-dihydro-1H-isoindole.
What is the SMILES notation for (1R)-1-propan-2-yl-2,3-dihydro-1H-isoindole?
The canonical SMILES for (1R)-1-propan-2-yl-2,3-dihydro-1H-isoindole is CC(C)[C@H]1NCc2ccccc21.
What is the InChIKey of (1R)-1-propan-2-yl-2,3-dihydro-1H-isoindole?
The InChIKey is KBOBAQOAQXTNCU-LLVKDONJSA-N. The full InChI is InChI=1S/C11H15N/c1-8(2)11-10-6-4-3-5-9(10)7-12-11/h3-6,8,11-12H,7H2,1-2H3/t11-/m1/s1.
What are the key properties of (1R)-1-propan-2-yl-2,3-dihydro-1H-isoindole?
(1R)-1-propan-2-yl-2,3-dihydro-1H-isoindole has a molecular weight of 161.25 g/mol, XLogP of 2.49, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-propan-2-yl-2,3-dihydro-1H-isoindole is sourced from PubChem (CID 158376445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).