C12H17N — CID 139332278
(1R)-1-tert-butyl-2,3-dihydro-1H-isoindole (PubChem CID 139332278) has the molecular formula C12H17N and a molecular weight of 175.28 g/mol. Its IUPAC name is (1R)-1-tert-butyl-2,3-dihydro-1H-isoindole.
| Compound Name | (1R)-1-tert-butyl-2,3-dihydro-1H-isoindole |
|---|---|
| PubChem CID | 139332278 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | (1R)-1-tert-butyl-2,3-dihydro-1H-isoindole |
| SMILES | CC(C)(C)[C@H]1NCc2ccccc21 |
| InChI | InChI=1S/C12H17N/c1-12(2,3)11-10-7-5-4-6-9(10)8-13-11/h4-7,11,13H,8H2,1-3H3/t11-/m0/s1 |
| InChIKey | KWUMTYTVQBXPHT-NSHDSACASA-N |
| XLogP | 2.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |