C19H26N2O7S2 — CID 158383473
4-(2-hydroxypropan-2-yl)-2-methylbenzenesulfonamide;methyl 3-methyl-4-sulfamoylbenzoate (PubChem CID 158383473) has the molecular formula C19H26N2O7S2 and a molecular weight of 458.56 g/mol. Its IUPAC name is 4-(2-hydroxypropan-2-yl)-2-methylbenzenesulfonamide;methyl 3-methyl-4-sulfamoylbenzoate.
| Compound Name | 4-(2-hydroxypropan-2-yl)-2-methylbenzenesulfonamide;methyl 3-methyl-4-sulfamoylbenzoate |
|---|---|
| PubChem CID | 158383473 |
| Molecular Formula | C19H26N2O7S2 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 4-(2-hydroxypropan-2-yl)-2-methylbenzenesulfonamide;methyl 3-methyl-4-sulfamoylbenzoate |
| SMILES | COC(=O)c1ccc(S(N)(=O)=O)c(C)c1.Cc1cc(C(C)(C)O)ccc1S(N)(=O)=O |
| InChI | InChI=1S/C10H15NO3S.C9H11NO4S/c1-7-6-8(10(2,3)12)4-5-9(7)15(11,13)14;1-6-5-7(9(11)14-2)3-4-8(6)15(10,12)13/h4-6,12H,1-3H3,(H2,11,13,14);3-5H,1-2H3,(H2,10,12,13) |
| InChIKey | GWBUZZZCLNCDJY-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 166.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |