C15H19NO5S — CID 172616052
ethane;methyl 3-methyl-4-(1,3-oxazol-5-ylmethylsulfonyl)benzoate (PubChem CID 172616052) has the molecular formula C15H19NO5S and a molecular weight of 325.39 g/mol. Its IUPAC name is ethane;methyl 3-methyl-4-(1,3-oxazol-5-ylmethylsulfonyl)benzoate.
| Compound Name | ethane;methyl 3-methyl-4-(1,3-oxazol-5-ylmethylsulfonyl)benzoate |
|---|---|
| PubChem CID | 172616052 |
| Molecular Formula | C15H19NO5S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | ethane;methyl 3-methyl-4-(1,3-oxazol-5-ylmethylsulfonyl)benzoate |
| SMILES | CC.COC(=O)c1ccc(S(=O)(=O)Cc2cnco2)c(C)c1 |
| InChI | InChI=1S/C13H13NO5S.C2H6/c1-9-5-10(13(15)18-2)3-4-12(9)20(16,17)7-11-6-14-8-19-11;1-2/h3-6,8H,7H2,1-2H3;1-2H3 |
| InChIKey | SJKSIFZWTCLZHP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 86.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |