C19H29N3O2Si — CID 158384111
tert-butyl (3S)-3-[[5-(2-trimethylsilylethynyl)pyrimidin-2-yl]methyl]pyrrolidine-1-carboxylate (PubChem CID 158384111) has the molecular formula C19H29N3O2Si and a molecular weight of 359.55 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[5-(2-trimethylsilylethynyl)pyrimidin-2-yl]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[[5-(2-trimethylsilylethynyl)pyrimidin-2-yl]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 158384111 |
| Molecular Formula | C19H29N3O2Si |
| Molecular Weight | 359.55 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | tert-butyl (3S)-3-[[5-(2-trimethylsilylethynyl)pyrimidin-2-yl]methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](Cc2ncc(C#C[Si](C)(C)C)cn2)C1 |
| InChI | InChI=1S/C19H29N3O2Si/c1-19(2,3)24-18(23)22-9-7-15(14-22)11-17-20-12-16(13-21-17)8-10-25(4,5)6/h12-13,15H,7,9,11,14H2,1-6H3/t15-/m0/s1 |
| InChIKey | XRFAEEIGAVHTSY-HNNXBMFYSA-N |
| XLogP | 3.51 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.55 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|