C13H16FNO — CID 158384542
6-tert-butyl-8-fluoro-7,8-dihydro-2H-isoquinolin-1-one (PubChem CID 158384542) has the molecular formula C13H16FNO and a molecular weight of 221.27 g/mol. Its IUPAC name is 6-tert-butyl-8-fluoro-7,8-dihydro-2H-isoquinolin-1-one.
| Compound Name | 6-tert-butyl-8-fluoro-7,8-dihydro-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 158384542 |
| Molecular Formula | C13H16FNO |
| Molecular Weight | 221.27 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 6-tert-butyl-8-fluoro-7,8-dihydro-2H-isoquinolin-1-one |
| SMILES | CC(C)(C)C1=Cc2cc[nH]c(=O)c2C(F)C1 |
| InChI | InChI=1S/C13H16FNO/c1-13(2,3)9-6-8-4-5-15-12(16)11(8)10(14)7-9/h4-6,10H,7H2,1-3H3,(H,15,16) |
| InChIKey | GWFBEAJFUIGDBX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |