C14H15Cl2N4O3P — CID 158387089
dichlorophosphoryloxymethane;(E)-3-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]prop-2-enenitrile (PubChem CID 158387089) has the molecular formula C14H15Cl2N4O3P and a molecular weight of 389.18 g/mol. Its IUPAC name is dichlorophosphoryloxymethane;(E)-3-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]prop-2-enenitrile.
| Compound Name | dichlorophosphoryloxymethane;(E)-3-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 158387089 |
| Molecular Formula | C14H15Cl2N4O3P |
| Molecular Weight | 389.18 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | dichlorophosphoryloxymethane;(E)-3-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]prop-2-enenitrile |
| SMILES | COP(=O)(Cl)Cl.COc1nc(/C=C/C#N)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C13H12N4O.CH3Cl2O2P/c1-10-8-17(9-15-10)12-6-5-11(4-3-7-14)16-13(12)18-2;1-5-6(2,3)4/h3-6,8-9H,1-2H3;1H3/b4-3+; |
| InChIKey | GWMOCZPPAKLQBU-BJILWQEISA-N |
| XLogP | 4.34 |
| TPSA | 90.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.18 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|