C13H12N4O — CID 66839224
(E)-3-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]prop-2-enenitrile (PubChem CID 66839224) has the molecular formula C13H12N4O and a molecular weight of 240.27 g/mol. Its IUPAC name is (E)-3-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]prop-2-enenitrile.
| Compound Name | (E)-3-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 66839224 |
| Molecular Formula | C13H12N4O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | (E)-3-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]prop-2-enenitrile |
| SMILES | COc1nc(/C=C/C#N)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C13H12N4O/c1-10-8-17(9-15-10)12-6-5-11(4-3-7-14)16-13(12)18-2/h3-6,8-9H,1-2H3/b4-3+ |
| InChIKey | MRPCVWZCHXDYSP-ONEGZZNKSA-N |
| XLogP | 2.12 |
| TPSA | 63.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|