C15H18N4O2 — CID 77194961
ethyl 3-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]prop-2-enimidate (PubChem CID 77194961) has the molecular formula C15H18N4O2 and a molecular weight of 286.34 g/mol. Its IUPAC name is ethyl 3-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]prop-2-enimidate.
| Compound Name | ethyl 3-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]prop-2-enimidate |
|---|---|
| PubChem CID | 77194961 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | ethyl 3-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]prop-2-enimidate |
| SMILES | [H]/N=C(/C=Cc1ccc(-n2cnc(C)c2)c(OC)n1)OCC |
| InChI | InChI=1S/C15H18N4O2/c1-4-21-14(16)8-6-12-5-7-13(15(18-12)20-3)19-9-11(2)17-10-19/h5-10,16H,4H2,1-3H3/b8-6?,16-14- |
| InChIKey | ZMWDBDYUKYUPGL-LXMSGDBZSA-N |
| XLogP | 2.61 |
| TPSA | 73.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|