C24H25N6O3+ — CID 158389390
1-[3-[3-(1,3-dimethylbenzotriazol-1-ium-5-yl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-4-phenylbutane-1,4-dione (PubChem CID 158389390) has the molecular formula C24H25N6O3+ and a molecular weight of 445.50 g/mol. Its IUPAC name is 1-[3-[3-(1,3-dimethylbenzotriazol-1-ium-5-yl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-4-phenylbutane-1,4-dione.
| Compound Name | 1-[3-[3-(1,3-dimethylbenzotriazol-1-ium-5-yl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-4-phenylbutane-1,4-dione |
|---|---|
| PubChem CID | 158389390 |
| Molecular Formula | C24H25N6O3+ |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 1-[3-[3-(1,3-dimethylbenzotriazol-1-ium-5-yl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-4-phenylbutane-1,4-dione |
| SMILES | Cn1n[n+](C)c2ccc(-c3noc(C4CCN(C(=O)CCC(=O)c5ccccc5)C4)n3)cc21 |
| InChI | InChI=1S/C24H25N6O3/c1-28-19-9-8-17(14-20(19)29(2)27-28)23-25-24(33-26-23)18-12-13-30(15-18)22(32)11-10-21(31)16-6-4-3-5-7-16/h3-9,14,18H,10-13,15H2,1-2H3/q+1 |
| InChIKey | MBWLZJATYXLXJT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 98.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|