About potassium;carbonic acid;iodide
potassium;carbonic acid;iodide (PubChem CID 158398287) has the molecular formula CH2IKO3
and a molecular weight of 228.03 g/mol. Its IUPAC name is potassium;carbonic acid;iodide.
Molecular Properties
| Compound Name | potassium;carbonic acid;iodide |
| PubChem CID | 158398287 |
| Molecular Formula | CH2IKO3 |
| Molecular Weight | 228.03 g/mol |
| Exact Mass | 227.87 |
| IUPAC Name | potassium;carbonic acid;iodide |
| SMILES | O=C(O)O.[I-].[K+] |
| InChI | InChI=1S/CH2O3.HI.K/c2-1(3)4;;/h(H2,2,3,4);1H;/q;;+1/p-1 |
| InChIKey | GXUDKAGLEQLXQV-UHFFFAOYSA-M |
| XLogP | -5.77 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.03 |
| LogP ≤ 5 | -5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze potassium;carbonic acid;iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;carbonic acid;iodide?
The IUPAC name of potassium;carbonic acid;iodide (CID 158398287) is potassium;carbonic acid;iodide.
What is the SMILES notation for potassium;carbonic acid;iodide?
The canonical SMILES for potassium;carbonic acid;iodide is O=C(O)O.[I-].[K+].
What is the InChIKey of potassium;carbonic acid;iodide?
The InChIKey is GXUDKAGLEQLXQV-UHFFFAOYSA-M. The full InChI is InChI=1S/CH2O3.HI.K/c2-1(3)4;;/h(H2,2,3,4);1H;/q;;+1/p-1.
What are the key properties of potassium;carbonic acid;iodide?
potassium;carbonic acid;iodide has a molecular weight of 228.03 g/mol, XLogP of -5.77, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;carbonic acid;iodide is sourced from PubChem (CID 158398287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).