About potassium;carbonic acid;methanone
potassium;carbonic acid;methanone (PubChem CID 172682054) has the molecular formula C2H3KO4
and a molecular weight of 130.14 g/mol. Its IUPAC name is potassium;carbonic acid;methanone.
Molecular Properties
| Compound Name | potassium;carbonic acid;methanone |
| PubChem CID | 172682054 |
| Molecular Formula | C2H3KO4 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 129.97 |
| IUPAC Name | potassium;carbonic acid;methanone |
| SMILES | O=C(O)O.[CH-]=O.[K+] |
| InChI | InChI=1S/CH2O3.CHO.K/c2-1(3)4;1-2;/h(H2,2,3,4);1H;/q;-1;+1 |
| InChIKey | JWFZRYPUXSTGHV-UHFFFAOYSA-N |
| XLogP | -3.05 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze potassium;carbonic acid;methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;carbonic acid;methanone?
The IUPAC name of potassium;carbonic acid;methanone (CID 172682054) is potassium;carbonic acid;methanone.
What is the SMILES notation for potassium;carbonic acid;methanone?
The canonical SMILES for potassium;carbonic acid;methanone is O=C(O)O.[CH-]=O.[K+].
What is the InChIKey of potassium;carbonic acid;methanone?
The InChIKey is JWFZRYPUXSTGHV-UHFFFAOYSA-N. The full InChI is InChI=1S/CH2O3.CHO.K/c2-1(3)4;1-2;/h(H2,2,3,4);1H;/q;-1;+1.
What are the key properties of potassium;carbonic acid;methanone?
potassium;carbonic acid;methanone has a molecular weight of 130.14 g/mol, XLogP of -3.05, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;carbonic acid;methanone is sourced from PubChem (CID 172682054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).