C34H41NO5 — CID 158401153
4-[[7-[(2-methyl-3-phenylphenyl)methoxy]-4-[(4-oxopentylamino)methyl]-2,3-dihydro-1H-inden-5-yl]oxy]butyl formate (PubChem CID 158401153) has the molecular formula C34H41NO5 and a molecular weight of 543.70 g/mol. Its IUPAC name is 4-[[7-[(2-methyl-3-phenylphenyl)methoxy]-4-[(4-oxopentylamino)methyl]-2,3-dihydro-1H-inden-5-yl]oxy]butyl formate.
| Compound Name | 4-[[7-[(2-methyl-3-phenylphenyl)methoxy]-4-[(4-oxopentylamino)methyl]-2,3-dihydro-1H-inden-5-yl]oxy]butyl formate |
|---|---|
| PubChem CID | 158401153 |
| Molecular Formula | C34H41NO5 |
| Molecular Weight | 543.70 g/mol |
| Exact Mass | 543.30 |
| IUPAC Name | 4-[[7-[(2-methyl-3-phenylphenyl)methoxy]-4-[(4-oxopentylamino)methyl]-2,3-dihydro-1H-inden-5-yl]oxy]butyl formate |
| SMILES | CC(=O)CCCNCc1c(OCCCCOC=O)cc(OCc2cccc(-c3ccccc3)c2C)c2c1CCC2 |
| InChI | InChI=1S/C34H41NO5/c1-25(37)11-10-18-35-22-32-30-16-9-17-31(30)33(21-34(32)39-20-7-6-19-38-24-36)40-23-28-14-8-15-29(26(28)2)27-12-4-3-5-13-27/h3-5,8,12-15,21,24,35H,6-7,9-11,16-20,22-23H2,1-2H3 |
| InChIKey | AUCGDDWPDYMSPO-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.70 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|