C34H40N2O3 — CID 157475930
5-[[5-(4-isocyanobutoxy)-7-[(2-methyl-3-phenylphenyl)methoxy]-2,3-dihydro-1H-inden-4-yl]methylamino]pentan-2-one (PubChem CID 157475930) has the molecular formula C34H40N2O3 and a molecular weight of 524.71 g/mol. Its IUPAC name is 5-[[5-(4-isocyanobutoxy)-7-[(2-methyl-3-phenylphenyl)methoxy]-2,3-dihydro-1H-inden-4-yl]methylamino]pentan-2-one.
| Compound Name | 5-[[5-(4-isocyanobutoxy)-7-[(2-methyl-3-phenylphenyl)methoxy]-2,3-dihydro-1H-inden-4-yl]methylamino]pentan-2-one |
|---|---|
| PubChem CID | 157475930 |
| Molecular Formula | C34H40N2O3 |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.30 |
| IUPAC Name | 5-[[5-(4-isocyanobutoxy)-7-[(2-methyl-3-phenylphenyl)methoxy]-2,3-dihydro-1H-inden-4-yl]methylamino]pentan-2-one |
| SMILES | [C-]#[N+]CCCCOc1cc(OCc2cccc(-c3ccccc3)c2C)c2c(c1CNCCCC(C)=O)CCC2 |
| InChI | InChI=1S/C34H40N2O3/c1-25(37)12-11-20-36-23-32-30-17-10-18-31(30)33(22-34(32)38-21-8-7-19-35-3)39-24-28-15-9-16-29(26(28)2)27-13-5-4-6-14-27/h4-6,9,13-16,22,36H,7-8,10-12,17-21,23-24H2,1-2H3 |
| InChIKey | RMJGXRLPHGULNY-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 51.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|