C22H34Fe — CID 158407839
iron(2+);bis(1,2,4-triethylcyclopenta-1,3-diene) (PubChem CID 158407839) has the molecular formula C22H34Fe and a molecular weight of 354.36 g/mol. Its IUPAC name is iron(2+);bis(1,2,4-triethylcyclopenta-1,3-diene).
| Compound Name | iron(2+);bis(1,2,4-triethylcyclopenta-1,3-diene) |
|---|---|
| PubChem CID | 158407839 |
| Molecular Formula | C22H34Fe |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | iron(2+);bis(1,2,4-triethylcyclopenta-1,3-diene) |
| SMILES | CCc1cc(CC)c(CC)[cH-]1.CCc1cc(CC)c(CC)[cH-]1.[Fe+2] |
| InChI | InChI=1S/2C11H17.Fe/c2*1-4-9-7-10(5-2)11(6-3)8-9;/h2*7-8H,4-6H2,1-3H3;/q2*-1;+2 |
| InChIKey | GYXQNGQYTDSHSF-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|