C8H11N2Y- — CID 158408414
N,3-dimethyl-6-methylidene-2H-pyridin-2-id-1-amine;yttrium (PubChem CID 158408414) has the molecular formula C8H11N2Y- and a molecular weight of 224.10 g/mol. Its IUPAC name is N,3-dimethyl-6-methylidene-2H-pyridin-2-id-1-amine;yttrium.
| Compound Name | N,3-dimethyl-6-methylidene-2H-pyridin-2-id-1-amine;yttrium |
|---|---|
| PubChem CID | 158408414 |
| Molecular Formula | C8H11N2Y- |
| Molecular Weight | 224.10 g/mol |
| Exact Mass | 224.00 |
| IUPAC Name | N,3-dimethyl-6-methylidene-2H-pyridin-2-id-1-amine;yttrium |
| SMILES | C=C1C=CC(C)=[C-]N1NC.[Y] |
| InChI | InChI=1S/C8H11N2.Y/c1-7-4-5-8(2)10(6-7)9-3;/h4-5,9H,2H2,1,3H3;/q-1; |
| InChIKey | JCBWMKODFGUTMZ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.10 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|