C40H43BrN2O4 — CID 158409516
1-bromoethylbenzene;ethyl 2-methyl-1H-indole-3-carboxylate;ethyl 2-methyl-1-(1-phenylethyl)indole-3-carboxylate (PubChem CID 158409516) has the molecular formula C40H43BrN2O4 and a molecular weight of 695.70 g/mol. Its IUPAC name is 1-bromoethylbenzene;ethyl 2-methyl-1H-indole-3-carboxylate;ethyl 2-methyl-1-(1-phenylethyl)indole-3-carboxylate.
| Compound Name | 1-bromoethylbenzene;ethyl 2-methyl-1H-indole-3-carboxylate;ethyl 2-methyl-1-(1-phenylethyl)indole-3-carboxylate |
|---|---|
| PubChem CID | 158409516 |
| Molecular Formula | C40H43BrN2O4 |
| Molecular Weight | 695.70 g/mol |
| Exact Mass | 694.24 |
| IUPAC Name | 1-bromoethylbenzene;ethyl 2-methyl-1H-indole-3-carboxylate;ethyl 2-methyl-1-(1-phenylethyl)indole-3-carboxylate |
| SMILES | CC(Br)c1ccccc1.CCOC(=O)c1c(C)[nH]c2ccccc12.CCOC(=O)c1c(C)n(C(C)c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C20H21NO2.C12H13NO2.C8H9Br/c1-4-23-20(22)19-15(3)21(18-13-9-8-12-17(18)19)14(2)16-10-6-5-7-11-16;1-3-15-12(14)11-8(2)13-10-7-5-4-6-9(10)11;1-7(9)8-5-3-2-4-6-8/h5-14H,4H2,1-3H3;4-7,13H,3H2,1-2H3;2-7H,1H3 |
| InChIKey | GZCVEZPEIHPALI-UHFFFAOYSA-N |
| XLogP | 10.53 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.70 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|