C20H17BrF2N4O3 — CID 158411090
5-bromo-6-fluoro-1H-indazole;tert-butyl 6-fluoro-5-formylindazole-1-carboxylate (PubChem CID 158411090) has the molecular formula C20H17BrF2N4O3 and a molecular weight of 479.28 g/mol. Its IUPAC name is 5-bromo-6-fluoro-1H-indazole;tert-butyl 6-fluoro-5-formylindazole-1-carboxylate.
| Compound Name | 5-bromo-6-fluoro-1H-indazole;tert-butyl 6-fluoro-5-formylindazole-1-carboxylate |
|---|---|
| PubChem CID | 158411090 |
| Molecular Formula | C20H17BrF2N4O3 |
| Molecular Weight | 479.28 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | 5-bromo-6-fluoro-1H-indazole;tert-butyl 6-fluoro-5-formylindazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1ncc2cc(C=O)c(F)cc21.Fc1cc2[nH]ncc2cc1Br |
| InChI | InChI=1S/C13H13FN2O3.C7H4BrFN2/c1-13(2,3)19-12(18)16-11-5-10(14)9(7-17)4-8(11)6-15-16;8-5-1-4-3-10-11-7(4)2-6(5)9/h4-7H,1-3H3;1-3H,(H,10,11) |
| InChIKey | GZHZESINVNNEFE-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.28 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|