C21H21BrF2N4O3 — CID 159554761
5-bromo-6-fluoro-1H-indazole;tert-butyl 6-fluoro-5-formylindazole-1-carboxylate;methane (PubChem CID 159554761) has the molecular formula C21H21BrF2N4O3 and a molecular weight of 495.32 g/mol. Its IUPAC name is 5-bromo-6-fluoro-1H-indazole;tert-butyl 6-fluoro-5-formylindazole-1-carboxylate;methane.
| Compound Name | 5-bromo-6-fluoro-1H-indazole;tert-butyl 6-fluoro-5-formylindazole-1-carboxylate;methane |
|---|---|
| PubChem CID | 159554761 |
| Molecular Formula | C21H21BrF2N4O3 |
| Molecular Weight | 495.32 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | 5-bromo-6-fluoro-1H-indazole;tert-butyl 6-fluoro-5-formylindazole-1-carboxylate;methane |
| SMILES | C.CC(C)(C)OC(=O)n1ncc2cc(C=O)c(F)cc21.Fc1cc2[nH]ncc2cc1Br |
| InChI | InChI=1S/C13H13FN2O3.C7H4BrFN2.CH4/c1-13(2,3)19-12(18)16-11-5-10(14)9(7-17)4-8(11)6-15-16;8-5-1-4-3-10-11-7(4)2-6(5)9;/h4-7H,1-3H3;1-3H,(H,10,11);1H4 |
| InChIKey | MFVOOTHJWDOYMM-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.32 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|