C17H25NO6 — CID 158414648
(1R,2R,4S,6S,10S)-2-hexyl-10-(methylcarbamoyloxy)-3,9-dioxatricyclo[4.4.0.02,4]dec-7-ene-7-carboxylic acid (PubChem CID 158414648) has the molecular formula C17H25NO6 and a molecular weight of 339.39 g/mol. Its IUPAC name is (1R,2R,4S,6S,10S)-2-hexyl-10-(methylcarbamoyloxy)-3,9-dioxatricyclo[4.4.0.02,4]dec-7-ene-7-carboxylic acid.
| Compound Name | (1R,2R,4S,6S,10S)-2-hexyl-10-(methylcarbamoyloxy)-3,9-dioxatricyclo[4.4.0.02,4]dec-7-ene-7-carboxylic acid |
|---|---|
| PubChem CID | 158414648 |
| Molecular Formula | C17H25NO6 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | (1R,2R,4S,6S,10S)-2-hexyl-10-(methylcarbamoyloxy)-3,9-dioxatricyclo[4.4.0.02,4]dec-7-ene-7-carboxylic acid |
| SMILES | CCCCCC[C@]12O[C@H]1C[C@@H]1C(C(=O)O)=CO[C@@H](OC(=O)NC)[C@H]12 |
| InChI | InChI=1S/C17H25NO6/c1-3-4-5-6-7-17-12(24-17)8-10-11(14(19)20)9-22-15(13(10)17)23-16(21)18-2/h9-10,12-13,15H,3-8H2,1-2H3,(H,18,21)(H,19,20)/t10-,12+,13+,15+,17+/m1/s1 |
| InChIKey | GZSUKAHQTAUJJY-KBDDINLNSA-N |
| XLogP | 2.41 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|